ChemNet > CAS > 41051-88-1 p-Xylene-d10
41051-88-1 p-Xylene-d10
| product Name |
p-Xylene-d10 |
| CAS No |
41051-88-1 |
| Synonyms |
(2H10)-p-Xylene; 1,4-bis[(~2~H_3_)methyl](~2~H_4_)benzene |
| Molecular Formula |
C8D10 |
| Molecular Weight |
116.2266 |
| InChI |
InChI=1/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D |
| EINECS |
255-193-6 |
| Molecular Structure |
|
| Density |
0.952g/cm3 |
| Melting point |
13℃ |
| Boiling point |
139.6°C at 760 mmHg |
| Refractive index |
1.5 |
| Flash point |
27.2°C |
| Vapour Pressur |
7.94mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R10:Flammable.;
R20/21:Harmful by inhalation and in contact with skin.;
R38:Irritating to skin.;
|
| Safety Description |
S25:Avoid contact with eyes.;
|
|
