ChemNet > CAS > 4122-68-3 4-Chlorophenoxyacetyl chloride
4122-68-3 4-Chlorophenoxyacetyl chloride
| product Name |
4-Chlorophenoxyacetyl chloride |
| CAS No |
4122-68-3 |
| Synonyms |
(4-Chlorophenoxy)acetyl chloride; p-chlorophenoxyacetyl chloride |
| Molecular Formula |
C8H6Cl2O2 |
| Molecular Weight |
205.038 |
| InChI |
InChI=1/C8H6Cl2O2/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2 |
| EINECS |
223-923-2 |
| Molecular Structure |
|
| Density |
1.363g/cm3 |
| Melting point |
18.8℃ |
| Boiling point |
264.5°C at 760 mmHg |
| Refractive index |
1.542 |
| Flash point |
112.9°C |
| Vapour Pressur |
0.00965mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
