ChemNet > CAS > 41444-33-1 (2-Thienylthio)acetone
41444-33-1 (2-Thienylthio)acetone
| product Name |
(2-Thienylthio)acetone |
| CAS No |
41444-33-1 |
| Synonyms |
1-(thiophen-2-ylsulfanyl)propan-2-one |
| Molecular Formula |
C7H8OS2 |
| Molecular Weight |
172.2678 |
| InChI |
InChI=1/C7H8OS2/c1-6(8)5-10-7-3-2-4-9-7/h2-4H,5H2,1H3 |
| Molecular Structure |
|
| Density |
1.22g/cm3 |
| Boiling point |
260.8°C at 760 mmHg |
| Refractive index |
1.582 |
| Flash point |
111.5°C |
| Vapour Pressur |
0.012mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
