ChemNet > CAS > 4146-43-4 Succinic dihydrazide
4146-43-4 Succinic dihydrazide
| product Name |
Succinic dihydrazide |
| Synonyms |
Butanedioyl dihydrazide; Succinic acid dihydrazide; butanedihydrazide |
| Molecular Formula |
C4H10N4O2 |
| Molecular Weight |
146.1478 |
| InChI |
InChI=1/C4H10N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10) |
| CAS Registry Number |
4146-43-4 |
| EINECS |
223-970-9 |
| Molecular Structure |
|
| Density |
1.284g/cm3 |
| Melting point |
170-168℃ |
| Boiling point |
540.2°C at 760 mmHg |
| Refractive index |
1.525 |
| Flash point |
280.5°C |
| Vapour Pressur |
9.79E-12mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
