ChemNet > CAS > 4151-80-8 4,4'-Biphenyldiboronic acid
4151-80-8 4,4'-Biphenyldiboronic acid
| product Name |
4,4'-Biphenyldiboronic acid |
| CAS No |
4151-80-8 |
| Synonyms |
biphenyl-4,4'-diyldiboronic acid |
| Molecular Formula |
C12H12B2O4 |
| Molecular Weight |
241.8433 |
| InChI |
InChI=1/C12H12B2O4/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18/h1-8,15-18H |
| Molecular Structure |
|
| Density |
1.31g/cm3 |
| Melting point |
300℃ (dec.) |
| Boiling point |
505.9°C at 760 mmHg |
| Refractive index |
1.62 |
| Flash point |
259.7°C |
| Vapour Pressur |
4.69E-11mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
