ChemNet > CAS > 4151-97-7 1-chloro-3-methoxy-2-propanol
4151-97-7 1-chloro-3-methoxy-2-propanol
| product Name |
1-chloro-3-methoxy-2-propanol |
| CAS No |
4151-97-7 |
| Synonyms |
3-Chloro-1-methoxy-2-propanol; 1-chloro-3-methoxypropan-2-ol |
| Molecular Formula |
C4H9ClO2 |
| Molecular Weight |
124.5661 |
| InChI |
InChI=1/C4H9ClO2/c1-7-3-4(6)2-5/h4,6H,2-3H2,1H3 |
| EINECS |
223-982-4 |
| Molecular Structure |
|
| Density |
1.13g/cm3 |
| Boiling point |
181.6°C at 760 mmHg |
| Refractive index |
1.433 |
| Flash point |
63.6°C |
| Vapour Pressur |
0.247mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36:Irritating to eyes.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
