ChemNet > CAS > 41513-04-6 1-Bromo-4-chloro-2-nitrobenzene
41513-04-6 1-Bromo-4-chloro-2-nitrobenzene
| product Name |
1-Bromo-4-chloro-2-nitrobenzene |
| CAS No |
41513-04-6 |
| Synonyms |
2-Bromo-5-chloronitrobenzene |
| Molecular Formula |
C6H3BrClNO2 |
| Molecular Weight |
236.4505 |
| InChI |
InChI=1/C6H3BrClNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
| EINECS |
255-421-4 |
| Molecular Structure |
|
| Density |
1.827g/cm3 |
| Melting point |
67-70℃ |
| Boiling point |
242.5°C at 760 mmHg |
| Refractive index |
1.618 |
| Flash point |
100.5°C |
| Vapour Pressur |
0.0527mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
