ChemNet > CAS > 41513-32-0 trans-1,4-Cyclohexenediol
41513-32-0 trans-1,4-Cyclohexenediol
| product Name |
trans-1,4-Cyclohexenediol |
| CAS No |
41513-32-0 |
| Synonyms |
(1S,4S)-cyclohex-2-ene-1,4-diol; (1R,4S)-cyclohex-2-ene-1,4-diol; (1R,4R)-cyclohex-2-ene-1,4-diol |
| Molecular Formula |
C6H10O2 |
| Molecular Weight |
114.1424 |
| InChI |
InChI=1/C6H10O2/c7-5-1-2-6(8)4-3-5/h1-2,5-8H,3-4H2/t5-,6-/m0/s1 |
| Molecular Structure |
|
| Density |
1.217g/cm3 |
| Melting point |
84-87℃ |
| Boiling point |
242.8°C at 760 mmHg |
| Refractive index |
1.563 |
| Flash point |
119.3°C |
| Vapour Pressur |
0.00565mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
