ChemNet > CAS > 41536-44-1 2-(4-Morpholino)phenol
41536-44-1 2-(4-Morpholino)phenol
| product Name |
2-(4-Morpholino)phenol |
| CAS No |
41536-44-1 |
| Synonyms |
2-Morpholinophenol; 4-(2-Hydroxyphenyl)morpholine |
| Molecular Formula |
C10H13NO2 |
| Molecular Weight |
179.2157 |
| InChI |
InChI=1/C10H13NO2/c12-10-4-2-1-3-9(10)11-5-7-13-8-6-11/h1-4,12H,5-8H2 |
| Molecular Structure |
|
| Density |
1.186g/cm3 |
| Melting point |
126℃ |
| Boiling point |
315.571°C at 760 mmHg |
| Refractive index |
1.575 |
| Flash point |
144.652°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
