ChemNet > CAS > 4160-63-8 2-(4-Methoxybenzoyl)thiophene
4160-63-8 2-(4-Methoxybenzoyl)thiophene
| product Name |
2-(4-Methoxybenzoyl)thiophene |
| CAS No |
4160-63-8 |
| Synonyms |
p-anisyl thiophen-2-yl ketone; (4-methoxyphenyl)(thiophen-2-yl)methanone; (4-methylphenyl)(thiophen-2-yl)methanone |
| Molecular Formula |
C12H10OS |
| Molecular Weight |
202.2722 |
| InChI |
InChI=1/C12H10OS/c1-9-4-6-10(7-5-9)12(13)11-3-2-8-14-11/h2-8H,1H3 |
| EINECS |
223-997-6 |
| Molecular Structure |
|
| Density |
1.167g/cm3 |
| Melting point |
73-76℃ |
| Boiling point |
340.6°C at 760 mmHg |
| Refractive index |
1.599 |
| Flash point |
159.8°C |
| Vapour Pressur |
8.52E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
