ChemNet > CAS > 4160-82-1 3,3-Dimethylglutaric anhydride
4160-82-1 3,3-Dimethylglutaric anhydride
| product Name |
3,3-Dimethylglutaric anhydride |
| CAS No |
4160-82-1 |
| Synonyms |
2H-Pyran-2,6(3H)-dione, dihydro-4,4-dimethyl-; AI3-11032; Glutaric anhydride, 3,3-dimethyl-; Glutaric anhydride, beta,beta-dimethyl-; NSC 2827; Dihydro-4,4-dimethyl-2H-pyran-2,6(3H)-dione; 4,4-dimethyldihydro-2H-pyran-2,6(3H)-dione; 3,3'-Dimethyl glutaric anhydride |
| Molecular Formula |
C7H10O3 |
| Molecular Weight |
142.1525 |
| InChI |
InChI=1/C7H10O3/c1-7(2)3-5(8)10-6(9)4-7/h3-4H2,1-2H3 |
| EINECS |
223-998-1 |
| Molecular Structure |
|
| Density |
1.102g/cm3 |
| Melting point |
122-126℃ |
| Boiling point |
299.5°C at 760 mmHg |
| Refractive index |
1.444 |
| Flash point |
104.9°C |
| Vapour Pressur |
0.00119mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
