ChemNet > CAS > 4165-56-4 1,4-Dibromobenzene-d4
4165-56-4 1,4-Dibromobenzene-d4
| product Name |
1,4-Dibromobenzene-d4 |
| Synonyms |
1,4-dibromo(~2~H_4_)benzene |
| Molecular Formula |
C6D4Br2 |
| Molecular Weight |
239.9286 |
| InChI |
InChI=1/C6H4Br2/c7-5-1-2-6(8)4-3-5/h1-4H/i1D,2D,3D,4D |
| CAS Registry Number |
4165-56-4 |
| Molecular Structure |
|
| Density |
1.969g/cm3 |
| Melting point |
88-90℃ |
| Boiling point |
217.9°C at 760 mmHg |
| Refractive index |
1.599 |
| Flash point |
89.3°C |
| Vapour Pressur |
0.191mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
1,4-Dibromobenzene-d4 Material Safety Data Sheet
|
|
