ChemNet > CAS > 41727-47-3 3,5-Dibromo-4-hydroxybenzoic acid methyl ester
41727-47-3 3,5-Dibromo-4-hydroxybenzoic acid methyl ester
| product Name |
3,5-Dibromo-4-hydroxybenzoic acid methyl ester |
| CAS No |
41727-47-3 |
| Synonyms |
Methyl 3,5-dibromo-4-hydroxybenzoate |
| Molecular Formula |
C8H6Br2O3 |
| Molecular Weight |
309.9394 |
| InChI |
InChI=1/C8H6Br2O3/c1-13-8(12)4-2-5(9)7(11)6(10)3-4/h2-3,11H,1H3 |
| EINECS |
255-521-8 |
| Molecular Structure |
|
| Density |
1.96g/cm3 |
| Melting point |
122℃ |
| Boiling point |
297.2°C at 760 mmHg |
| Refractive index |
1.616 |
| Flash point |
133.5°C |
| Vapour Pressur |
0.000775mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
