ChemNet > CAS > 4184-79-6 5,6-Dimethyl-1H-benzotriazole hydrate
4184-79-6 5,6-Dimethyl-1H-benzotriazole hydrate
| product Name |
5,6-Dimethyl-1H-benzotriazole hydrate |
| CAS No |
4184-79-6 |
| Synonyms |
5,6-Dimethylbenzotriazole monohydrate; 5,6-dimethyl-2H-benzotriazole |
| Molecular Formula |
C8H9N3 |
| Molecular Weight |
147.1772 |
| InChI |
InChI=1/C8H9N3/c1-5-3-7-8(4-6(5)2)10-11-9-7/h3-4H,1-2H3,(H,9,10,11) |
| EINECS |
224-058-3 |
| Molecular Structure |
|
| Density |
1.217g/cm3 |
| Melting point |
153-156℃ |
| Boiling point |
309.7°C at 760 mmHg |
| Refractive index |
1.655 |
| Flash point |
145.6°C |
| Vapour Pressur |
0.000628mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
