ChemNet > CAS > 4187-87-5 (+/-)-1-phenyl-2-propyn-1-ol
4187-87-5 (+/-)-1-phenyl-2-propyn-1-ol
| product Name |
(+/-)-1-phenyl-2-propyn-1-ol |
| CAS No |
4187-87-5 |
| Synonyms |
Phenylpropynol; 1-Phenyl-2-propyn-1-ol |
| Molecular Formula |
C9H8O |
| Molecular Weight |
132.16 |
| InChI |
InChI=1/C9H8O/c1-2-9(10)8-6-4-3-5-7-8/h1,3-7,9-10H |
| EINECS |
224-064-6 |
| Molecular Structure |
|
| Density |
1.087 |
| Melting point |
22-24℃ |
| Boiling point |
231℃(13 torr) |
| Hazard Symbols |
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
