ChemNet > CAS > 41947-61-9 sodium hydrogen malate, ester with glycerol (3:1)
41947-61-9 sodium hydrogen malate, ester with glycerol (3:1)
| product Name |
sodium hydrogen malate, ester with glycerol (3:1) |
| CAS No |
41947-61-9 |
| Synonyms |
Sodium hydrogen malate, ester with glycerol (3:1); trisodium 4,4',4''-[propane-1,2,3-triyltris(oxy)]tris(3-hydroxy-4-oxobutanoate) |
| Molecular Formula |
C15H17Na3O15 |
| Molecular Weight |
506.2558 |
| InChI |
InChI=1/C15H20O15.3Na/c16-7(1-10(19)20)13(25)28-4-6(30-15(27)9(18)3-12(23)24)5-29-14(26)8(17)2-11(21)22;;;/h6-9,16-18H,1-5H2,(H,19,20)(H,21,22)(H,23,24);;;/q;3*+1/p-3 |
| EINECS |
255-598-8 |
| Molecular Structure |
|
| Boiling point |
687°C at 760 mmHg |
| Flash point |
244.1°C |
| Vapour Pressur |
7.64E-22mmHg at 25°C |
|