ChemNet > CAS > 41994-51-8 1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid hydrochloride
41994-51-8 1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid hydrochloride
| product Name |
1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid hydrochloride |
| CAS No |
41994-51-8 |
| Synonyms |
H-Dl-Tic-Oh |
| Molecular Formula |
C10H12ClNO2 |
| Molecular Weight |
213.6608 |
| InChI |
InChI=1/C10H11NO2.ClH/c12-10(13)9-5-7-3-1-2-4-8(7)6-11-9;/h1-4,9,11H,5-6H2,(H,12,13);1H |
| EINECS |
255-610-1 |
| Molecular Structure |
|
| Melting point |
299-301℃ |
| Boiling point |
372°C at 760 mmHg |
| Flash point |
178.8°C |
| Vapour Pressur |
3.41E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
