ChemNet > CAS > 42014-74-4 Bromoconduritol (Mixture of Isomers)
42014-74-4 Bromoconduritol (Mixture of Isomers)
| product Name |
Bromoconduritol (Mixture of Isomers) |
| CAS No |
42014-74-4 |
| Synonyms |
6-Bromoconduritol; Bromoconduritol; 4-Cyclohexene-1,2,3-triol, 6-bromo-; 6-bromocyclohex-4-ene-1,2,3-triol |
| Molecular Formula |
C6H9BrO3 |
| Molecular Weight |
209.0379 |
| InChI |
InChI=1/C6H9BrO3/c7-3-1-2-4(8)6(10)5(3)9/h1-6,8-10H |
| Molecular Structure |
|
| Density |
1.989g/cm3 |
| Boiling point |
291.6°C at 760 mmHg |
| Refractive index |
1.682 |
| Flash point |
130.1°C |
| Vapour Pressur |
0.000208mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
