ChemNet > CAS > 42059-81-4 3-formyl-6-methylchromone
42059-81-4 3-formyl-6-methylchromone
| product Name |
3-formyl-6-methylchromone |
| CAS No |
42059-81-4 |
| Molecular Formula |
C11H8O3 |
| Molecular Weight |
188.1794 |
| InChI |
InChI=1/C11H8O3/c1-7-2-3-10-9(4-7)11(13)8(5-12)6-14-10/h2-6H,1H3 |
| Molecular Structure |
|
| Density |
1.364g/cm3 |
| Melting point |
172℃ |
| Boiling point |
335.1°C at 760 mmHg |
| Refractive index |
1.664 |
| Flash point |
150.3°C |
| Vapour Pressur |
0.000123mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
