ChemNet > CAS > 42087-80-9 Methyl 4-Chloro-2-Nitrobenzoate
42087-80-9 Methyl 4-Chloro-2-Nitrobenzoate
| product Name |
Methyl 4-Chloro-2-Nitrobenzoate |
| CAS No |
42087-80-9 |
| Synonyms |
4-Chloro-2-nitrobenzoic acid methyl ester |
| Molecular Formula |
C8H6ClNO4 |
| Molecular Weight |
215.5905 |
| InChI |
InChI=1/C8H6ClNO4/c1-14-8(11)6-3-2-5(9)4-7(6)10(12)13/h2-4H,1H3 |
| EINECS |
255-654-1 |
| Molecular Structure |
|
| Density |
1.426g/cm3 |
| Melting point |
43-45℃ |
| Boiling point |
285.6°C at 760 mmHg |
| Refractive index |
1.568 |
| Flash point |
126.5°C |
| Vapour Pressur |
0.00277mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
