ChemNet > CAS > 4214-79-3 5-Chloro-2-pyridinol
4214-79-3 5-Chloro-2-pyridinol
| product Name |
5-Chloro-2-pyridinol |
| Synonyms |
5-Chloro-2-hydroxypyridine; 5-Chloro-2-hydrxypyridine; 2-Hydroxy-5-chloropyridine; 2-hydroxy-5-chloro pyridine; 5-chloropyridin-2(1H)-one; 5-Chloropyridin-2-ol; 5-Chloropyridin-2-ol |
| Molecular Formula |
C5H4ClNO |
| Molecular Weight |
129.5444 |
| InChI |
InChI=1/C5H4ClNO/c6-4-1-2-5(8)7-3-4/h1-3H,(H,7,8) |
| CAS Registry Number |
4214-79-3 |
| EINECS |
224-146-1 |
| Molecular Structure |
|
| Density |
1.35g/cm3 |
| Melting point |
162-165℃ |
| Boiling point |
290.7°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
129.6°C |
| Vapour Pressur |
0.00204mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
5-Chloro-2-pyridinol Material Safety Data Sheet
|
|
