ChemNet > CAS > 42287-90-1 3-(3-Bromophenyl)propionic acid
42287-90-1 3-(3-Bromophenyl)propionic acid
| product Name |
3-(3-Bromophenyl)propionic acid |
| CAS No |
42287-90-1 |
| Synonyms |
3-(3-bromophenyl)propanoic acid |
| Molecular Formula |
C9H9BrO2 |
| Molecular Weight |
229.0706 |
| InChI |
InChI=1/C9H9BrO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5H2,(H,11,12) |
| Molecular Structure |
|
| Density |
1.531g/cm3 |
| Melting point |
72-76℃ |
| Boiling point |
336.3°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
157.2°C |
| Vapour Pressur |
4.44E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
