ChemNet > CAS > 423768-55-2 (2-morpholino-3-pyridinyl)methanol
423768-55-2 (2-morpholino-3-pyridinyl)methanol
| product Name |
(2-morpholino-3-pyridinyl)methanol |
| CAS No |
423768-55-2 |
| Synonyms |
(2-morpholin-4-ylpyridin-3-yl)methanol |
| Molecular Formula |
C10H14N2O2 |
| Molecular Weight |
194.2304 |
| InChI |
InChI=1/C10H14N2O2/c13-8-9-2-1-3-11-10(9)12-4-6-14-7-5-12/h1-3,13H,4-8H2 |
| Molecular Structure |
|
| Density |
1.215g/cm3 |
| Melting point |
78℃ |
| Boiling point |
397°C at 760 mmHg |
| Refractive index |
1.572 |
| Flash point |
193.9°C |
| Vapour Pressur |
5.15E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
