CAS No: 427-17-8, Chemical Name: 5-ethyl-5-(3-hydroxyphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione
the physical and chemical property of 427-17-8, 5-ethyl-5-(3-hydroxyphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione is provided by ChemNet.com
ChemNet > CAS > 427-17-8 5-ethyl-5-(3-hydroxyphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione
427-17-8 5-ethyl-5-(3-hydroxyphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione
| product Name |
5-ethyl-5-(3-hydroxyphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione |
| Synonyms |
2,4,6(1H,3H,5H)-pyrimidinetrione, 5-ethyl-5-(3-hydroxyphenyl)-; 5-Ethyl-5-(3-hydroxyphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione |
| Molecular Formula |
C12H12N2O4 |
| Molecular Weight |
248.2347 |
| InChI |
InChI=1/C12H12N2O4/c1-2-12(7-4-3-5-8(15)6-7)9(16)13-11(18)14-10(12)17/h3-6,15H,2H2,1H3,(H2,13,14,16,17,18) |
| CAS Registry Number |
427-17-8 |
| Molecular Structure |
|
| Density |
1.33g/cm3 |
| Refractive index |
1.568 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
