ChemNet > CAS > 42712-64-1 2-Amino-4-hydroxyquinoline hydrate
42712-64-1 2-Amino-4-hydroxyquinoline hydrate
| product Name |
2-Amino-4-hydroxyquinoline hydrate |
| CAS No |
42712-64-1 |
| Synonyms |
2-Aminoquinolinol hydrate; 2-aminoquinolin-4(1H)-one; 2-Amino-4-1H-quinolinone |
| Molecular Formula |
C9H8N2O |
| Molecular Weight |
160.1726 |
| InChI |
InChI=1/C9H8N2O/c10-9-5-8(12)6-3-1-2-4-7(6)11-9/h1-5H,(H3,10,11,12) |
| Molecular Structure |
|
| Density |
1.254g/cm3 |
| Boiling point |
294.1°C at 760 mmHg |
| Refractive index |
1.623 |
| Flash point |
131.7°C |
| Vapour Pressur |
0.00166mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
