ChemNet > CAS > 42754-62-1 5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
42754-62-1 5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
| product Name |
5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| CAS No |
42754-62-1 |
| Synonyms |
3-amino-5-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| Molecular Formula |
C10H7ClN4 |
| Molecular Weight |
218.6424 |
| InChI |
InChI=1/C10H7ClN4/c11-7-3-1-6(2-4-7)9-8(5-12)10(13)15-14-9/h1-4H,(H3,13,14,15) |
| Molecular Structure |
|
| Density |
1.48g/cm3 |
| Melting point |
212℃ |
| Boiling point |
554.7°C at 760 mmHg |
| Refractive index |
1.688 |
| Flash point |
289.3°C |
| Vapour Pressur |
2.41E-12mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
