ChemNet > CAS > 42783-78-8 Benzyloxyacetaldehyde diethyl acetal
42783-78-8 Benzyloxyacetaldehyde diethyl acetal
| product Name |
Benzyloxyacetaldehyde diethyl acetal |
| CAS No |
42783-78-8 |
| Synonyms |
1,1-diethoxy-2-benzyloxyethane; [(2,2-diethoxyethoxy)methyl]benzene |
| Molecular Formula |
C13H20O3 |
| Molecular Weight |
224.2961 |
| InChI |
InChI=1/C13H20O3/c1-3-15-13(16-4-2)11-14-10-12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3 |
| Molecular Structure |
|
| Density |
1g/cm3 |
| Boiling point |
288.8°C at 760 mmHg |
| Refractive index |
1.484 |
| Flash point |
110.9°C |
| Vapour Pressur |
0.00397mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
