ChemNet > CAS > 42855-00-5 6-nitroveratryl chloroformate
42855-00-5 6-nitroveratryl chloroformate
| product Name |
6-nitroveratryl chloroformate |
| CAS No |
42855-00-5 |
| Synonyms |
4,5-dimethoxy-2-nitrobenzyl chloroformate; Chloroformic acid 6-nitroveratryl ester~4,5-Dimethoxy-2-nitrobenzyl chloroformate~NVOC-Cl; 4,5-dimethoxy-2-nitrobenzyl chlorocarbonate |
| Molecular Formula |
C10H10ClNO6 |
| Molecular Weight |
275.6425 |
| InChI |
InChI=1/C10H10ClNO6/c1-16-8-3-6(5-18-10(11)13)7(12(14)15)4-9(8)17-2/h3-4H,5H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.399g/cm3 |
| Melting point |
125℃ |
| Boiling point |
396.4°C at 760 mmHg |
| Refractive index |
1.545 |
| Flash point |
193.5°C |
| Vapour Pressur |
1.72E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
R37:Irritating to respiratory system.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
