4295-06-1 4-Chloroquinaldine
product Name |
4-Chloroquinaldine |
CAS No |
4295-06-1 |
Synonyms |
4-Chloro-2-methylquinoline; 2-Methyl-4-chloroquinoline |
Molecular Formula |
C10H8ClN |
Molecular Weight |
177.6302 |
InChI |
InChI=1/C10H8ClN/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3 |
EINECS |
224-300-8 |
Molecular Structure |
|
Density |
1.225g/cm3 |
Melting point |
39-270℃ |
Boiling point |
269.5°C at 760 mmHg |
Refractive index |
1.634 |
Flash point |
140.2°C |
Vapour Pressur |
0.012mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|