ChemNet > CAS > 4341-24-6 5-Methylcyclohexane-1,3-dione
4341-24-6 5-Methylcyclohexane-1,3-dione
| product Name |
5-Methylcyclohexane-1,3-dione |
| CAS No |
4341-24-6 |
| Synonyms |
(5S)-3-hydroxy-5-methylcyclohex-2-en-1-one |
| Molecular Formula |
C7H10O2 |
| Molecular Weight |
126.1531 |
| InChI |
InChI=1/C7H10O2/c1-5-2-6(8)4-7(9)3-5/h4-5,8H,2-3H2,1H3/t5-/m0/s1 |
| Molecular Structure |
|
| Density |
1.134g/cm3 |
| Melting point |
129-131℃ |
| Boiling point |
221.6°C at 760 mmHg |
| Refractive index |
1.517 |
| Flash point |
89.1°C |
| Vapour Pressur |
0.0219mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
