ChemNet > CAS > 4402-83-9 methyl 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate
4402-83-9 methyl 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate
| product Name |
methyl 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate |
| CAS No |
4402-83-9 |
| Synonyms |
methyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| Molecular Formula |
C12H9Cl2NO3 |
| Molecular Weight |
286.1108 |
| InChI |
InChI=1/C12H9Cl2NO3/c1-6-9(12(16)17-2)11(15-18-6)10-7(13)4-3-5-8(10)14/h3-5H,1-2H3 |
| Molecular Structure |
|
| Density |
1.37g/cm3 |
| Melting point |
115℃ |
| Boiling point |
382.4°C at 760 mmHg |
| Refractive index |
1.561 |
| Flash point |
185.1°C |
| Vapour Pressur |
4.72E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
