ChemNet > CAS > 441-38-3 alpha-Benzoin oxime
441-38-3 alpha-Benzoin oxime
| product Name |
alpha-Benzoin oxime |
| Synonyms |
2-Hydroxy-1,2-diphenylethanone oxime (alpha-form); a-Benzoin oxime, (Cupron); (1E)-2-hydroxy-1,2-diphenylethanone oxime; (1Z)-2-hydroxy-1,2-diphenylethanone oxime; (1Z,2S)-2-hydroxy-1,2-diphenylethanone oxime; (1E,2S)-2-hydroxy-1,2-diphenylethanone oxime; (1Z,2R)-2-hydroxy-1,2-diphenylethanone oxime; α-Benzoin oxime; Benzoin α-oxime |
| Molecular Formula |
C14H13NO2 |
| Molecular Weight |
227.2585 |
| InChI |
InChI=1/C14H13NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,14,16-17H/b15-13-/t14-/m1/s1 |
| CAS Registry Number |
441-38-3 |
| EINECS |
207-127-2 |
| Molecular Structure |
|
| Density |
1.13g/cm3 |
| Melting point |
150-155℃ |
| Boiling point |
417.8°C at 760 mmHg |
| Refractive index |
1.58 |
| Flash point |
270.4°C |
| Vapour Pressur |
9.98E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
alpha-Benzoin oxime Material Safety Data Sheet
|
|
