ChemNet > CAS > 4411-26-1 1-Adamantyl isothiocyanate
4411-26-1 1-Adamantyl isothiocyanate
| product Name |
1-Adamantyl isothiocyanate |
| Synonyms |
tricyclo(3.3.1.13,7)dec-1-yl isocyanate; Isothiocyanic acid 1-adamantyl estr; 1-isothiocyanatotricyclo[3.3.1.1~3,7~]decane |
| Molecular Formula |
C11H15NS |
| Molecular Weight |
193.3085 |
| InChI |
InChI=1/C11H15NS/c13-7-12-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-6H2 |
| CAS Registry Number |
4411-26-1 |
| EINECS |
224-564-4 |
| Molecular Structure |
|
| Density |
1.35g/cm3 |
| Melting point |
166-168℃ |
| Boiling point |
297.6°C at 760 mmHg |
| Refractive index |
1.721 |
| Flash point |
138°C |
| Vapour Pressur |
0.00237mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
