ChemNet > CAS > 4433-30-1 Undecanophenone
4433-30-1 Undecanophenone
| product Name |
Undecanophenone |
| CAS No |
4433-30-1 |
| Synonyms |
n-Decyl phenyl ketone; 1-phenylundecan-2-one |
| Molecular Formula |
C17H26O |
| Molecular Weight |
246.3877 |
| InChI |
InChI=1/C17H26O/c1-2-3-4-5-6-7-11-14-17(18)15-16-12-9-8-10-13-16/h8-10,12-13H,2-7,11,14-15H2,1H3 |
| EINECS |
224-633-9 |
| Molecular Structure |
|
| Density |
0.92g/cm3 |
| Melting point |
28-30℃ |
| Boiling point |
342.846°C at 760 mmHg |
| Refractive index |
1.49 |
| Flash point |
114.968°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
