ChemNet > CAS > 4437-85-8 4-Ethyl-1,3-dioxolan-2-one
4437-85-8 4-Ethyl-1,3-dioxolan-2-one
| product Name |
4-Ethyl-1,3-dioxolan-2-one |
| CAS No |
4437-85-8 |
| Synonyms |
Butylene carbonate; (4S)-4-ethyl-1,3-dioxolan-2-one; (4R)-4-ethyl-1,3-dioxolan-2-one; 4-(carboxyoxy)butyl carbonate |
| Molecular Formula |
C6H9O6 |
| Molecular Weight |
177.1326 |
| InChI |
InChI=1/C6H10O6/c7-5(8)11-3-1-2-4-12-6(9)10/h1-4H2,(H,7,8)(H,9,10)/p-1 |
| Molecular Structure |
|
| Boiling point |
361.205°C at 760 mmHg |
| Flash point |
152.029°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
