ChemNet > CAS > 4476-28-2 4-Isopropylphenylacetic acid
4476-28-2 4-Isopropylphenylacetic acid
| product Name |
4-Isopropylphenylacetic acid |
| CAS No |
4476-28-2 |
| Synonyms |
AI3-12008; Benzeneacetic acid, 4-(1-methylethyl)-; [4-(propan-2-yl)phenyl]acetic acid; [4-(1-methylethyl)phenyl]acetate |
| Molecular Formula |
C11H13O2 |
| Molecular Weight |
177.2203 |
| InChI |
InChI=1/C11H14O2/c1-8(2)10-5-3-9(4-6-10)7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13)/p-1 |
| EINECS |
224-755-2 |
| Molecular Structure |
|
| Boiling point |
295°C at 760 mmHg |
| Flash point |
192.1°C |
| Vapour Pressur |
0.00071mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
