ChemNet > CAS > 4485-09-0 4-Nonanone
4485-09-0 4-Nonanone
| product Name |
4-Nonanone |
| CAS No |
4485-09-0 |
| Synonyms |
nonan-4-one |
| Molecular Formula |
C9H18O |
| Molecular Weight |
142.2386 |
| InChI |
InChI=1/C9H18O/c1-3-5-6-8-9(10)7-4-2/h3-8H2,1-2H3 |
| EINECS |
224-770-4 |
| Molecular Structure |
|
| Density |
0.816g/cm3 |
| Boiling point |
190°C at 760 mmHg |
| Refractive index |
1.416 |
| Flash point |
61.4°C |
| Vapour Pressur |
0.553mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
