ChemNet > CAS > 45019-28-1 4-Methylnonanoic acid
45019-28-1 4-Methylnonanoic acid
| product Name |
4-Methylnonanoic acid |
| CAS No |
45019-28-1 |
| Synonyms |
Nonanoic acid, 4-methyl-; 4-Methylpelargonic acid; AI3-30047; FEMA No. 3574; 4-Methylnonan-1-oic acid; (4R)-4-methylnonanoate; (4S)-4-methylnonanoate |
| Molecular Formula |
C10H19O2 |
| Molecular Weight |
171.2572 |
| InChI |
InChI=1/C10H20O2/c1-3-4-5-6-9(2)7-8-10(11)12/h9H,3-8H2,1-2H3,(H,11,12)/p-1/t9-/m0/s1 |
| EINECS |
256-180-8 |
| Molecular Structure |
|
| Boiling point |
271.6°C at 760 mmHg |
| Flash point |
142.3°C |
| Vapour Pressur |
0.00178mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
