ChemNet > CAS > 452-64-2 1,2-Dimethyl-4-fluorobenzene
452-64-2 1,2-Dimethyl-4-fluorobenzene
| product Name |
1,2-Dimethyl-4-fluorobenzene |
| CAS No |
452-64-2 |
| Synonyms |
Fluoroxylene2; Fluorooxylene; 3,4-Dimethylfluorobenzene; 4-(Trifluoromethyl)-o-xylene; 4-fluoro-1,2-dimethylbenzene; 1-fluoro-2,4-dimethylbenzene; 4-Fluoro-o-xylene |
| Molecular Formula |
C8H9F |
| Molecular Weight |
124.1555 |
| InChI |
InChI=1/C8H9F/c1-6-3-4-8(9)7(2)5-6/h3-5H,1-2H3 |
| Molecular Structure |
|
| Density |
0.984g/cm3 |
| Boiling point |
144.62°C at 760 mmHg |
| Refractive index |
1.481 |
| Flash point |
30.873°C |
| Vapour Pressur |
6.357mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
