ChemNet > CAS > 4521-33-9 5-Nitrothiophene-2-carboxaldehyde
4521-33-9 5-Nitrothiophene-2-carboxaldehyde
| product Name |
5-Nitrothiophene-2-carboxaldehyde |
| CAS No |
4521-33-9 |
| Synonyms |
5-Nitrothiophene-2-carbaldehyde |
| Molecular Formula |
C5H3NO3S |
| Molecular Weight |
157.1472 |
| InChI |
InChI=1/C5H3NO3S/c7-3-4-1-2-5(10-4)6(8)9/h1-3H |
| EINECS |
224-850-9 |
| Molecular Structure |
|
| Density |
1.534g/cm3 |
| Boiling point |
297.2°C at 760 mmHg |
| Refractive index |
1.662 |
| Flash point |
133.5°C |
| Vapour Pressur |
0.00137mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
