ChemNet > CAS > 4534-74-1 4-Ethylcyclohexanol
4534-74-1 4-Ethylcyclohexanol
| product Name |
4-Ethylcyclohexanol |
| CAS No |
4534-74-1 |
| Synonyms |
Ethylcyclohexanol; 4-Ethylcyclohexanol, mixture of cis- and trans isomers; Ethyl cyclohexanol |
| Molecular Formula |
C8H16O |
| Molecular Weight |
128.21 |
| InChI |
InChI=1/C8H16O/c1-2-7-3-5-8(9)6-4-7/h7-9H,2-6H2,1H3 |
| EINECS |
224-878-1 |
| Molecular Structure |
|
| Density |
0.889 |
| Boiling point |
83.4-84.4℃ (10 mmHg) |
| Refractive index |
1.461-1.463 |
| Flash point |
77℃ |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
