ChemNet > CAS > 454-29-5 DL-Homocysteine
454-29-5 DL-Homocysteine
| product Name |
DL-Homocysteine |
| CAS No |
454-29-5 |
| Synonyms |
DL-Homocysteine 2-Amino-4-mercaptobuyric acid; homocysteine; D-homocysteine |
| Molecular Formula |
C4H9NO2S |
| Molecular Weight |
135.1848 |
| InChI |
InChI=1/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m1/s1 |
| EINECS |
207-222-9 |
| Molecular Structure |
|
| Density |
1.259g/cm3 |
| Melting point |
232-233℃ |
| Boiling point |
299.7°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
135°C |
| Vapour Pressur |
0.000278mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
