ChemNet > CAS > 455-67-4 3-fluoropropiophenone
455-67-4 3-fluoropropiophenone
| product Name |
3-fluoropropiophenone |
| CAS No |
455-67-4 |
| Synonyms |
3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
| Molecular Formula |
C9H9FO |
| Molecular Weight |
152.1656 |
| InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| Molecular Structure |
|
| Density |
1.074g/cm3 |
| Boiling point |
209.8°C at 760 mmHg |
| Refractive index |
1.489 |
| Flash point |
79.8°C |
| Vapour Pressur |
0.199mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
