ChemNet > CAS > 4553-07-5 Ethyl phenylcyanoacetate
4553-07-5 Ethyl phenylcyanoacetate
| product Name |
Ethyl phenylcyanoacetate |
| CAS No |
4553-07-5 |
| Synonyms |
Phenylcyanoacetic acid ethyl ester; ethyl cyano(phenyl)acetate; ethyl (2R)-cyano(phenyl)ethanoate; ethyl (2S)-cyano(phenyl)ethanoate; ethyl 2-cyano-2-phenylacetate |
| Molecular Formula |
C11H11NO2 |
| Molecular Weight |
189.2105 |
| InChI |
InChI=1/C11H11NO2/c1-2-14-11(13)10(8-12)9-6-4-3-5-7-9/h3-7,10H,2H2,1H3/t10-/m1/s1 |
| EINECS |
224-921-4 |
| Molecular Structure |
|
| Density |
1.117g/cm3 |
| Boiling point |
275°C at 760 mmHg |
| Refractive index |
1.518 |
| Flash point |
137.5°C |
| Vapour Pressur |
0.00523mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
|
| MSDS |
Material Safety Data Sheet
|
|
