ChemNet > CAS > 45534-08-5 3-Amino-5-methylthio-1H-1,2,4-triazole
45534-08-5 3-Amino-5-methylthio-1H-1,2,4-triazole
| product Name |
3-Amino-5-methylthio-1H-1,2,4-triazole |
| CAS No |
45534-08-5 |
| Molecular Formula |
C3H6N4S |
| Molecular Weight |
130.1715 |
| InChI |
InChI=1/C3H6N4S/c1-8-3-5-2(4)6-7-3/h1H3,(H3,4,5,6,7) |
| EINECS |
256-242-4 |
| Molecular Structure |
|
| Density |
1.46g/cm3 |
| Melting point |
130-133℃ |
| Boiling point |
393.7°C at 760 mmHg |
| Refractive index |
1.652 |
| Flash point |
191.9°C |
| Vapour Pressur |
2.08E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
