ChemNet > CAS > 4559-96-0 4'-Bromo-4-chlorobutyrophenone
4559-96-0 4'-Bromo-4-chlorobutyrophenone
| product Name |
4'-Bromo-4-chlorobutyrophenone |
| CAS No |
4559-96-0 |
| Synonyms |
1-(4-Bromophenyl)-4-chloro-1-butanone; 4?Bromo-4-chlorobutyrophenone; 1-(4-bromophenyl)-4-chlorobutan-1-one |
| Molecular Formula |
C10H10BrClO |
| Molecular Weight |
261.5428 |
| InChI |
InChI=1/C10H10BrClO/c11-9-5-3-8(4-6-9)10(13)2-1-7-12/h3-6H,1-2,7H2 |
| EINECS |
224-930-3 |
| Molecular Structure |
|
| Density |
1.44g/cm3 |
| Melting point |
35-38℃ |
| Boiling point |
352.8°C at 760 mmHg |
| Refractive index |
1.552 |
| Flash point |
167.2°C |
| Vapour Pressur |
3.74E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
