ChemNet > CAS > 4567-98-0 dimethyl undecanedioate
4567-98-0 dimethyl undecanedioate
| product Name |
dimethyl undecanedioate |
| CAS No |
4567-98-0 |
| Synonyms |
224-943-4; undecanedioic acid, dimethyl ester |
| Molecular Formula |
C13H24O4 |
| Molecular Weight |
244.3273 |
| InChI |
InChI=1/C13H24O4/c1-16-12(14)10-8-6-4-3-5-7-9-11-13(15)17-2/h3-11H2,1-2H3 |
| EINECS |
224-943-4 |
| Molecular Structure |
|
| Density |
0.976g/cm3 |
| Melting point |
17-19℃ |
| Boiling point |
287.7°C at 760 mmHg |
| Refractive index |
1.439 |
| Flash point |
129.2°C |
| Vapour Pressur |
0.00244mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
