ChemNet > CAS > 4572-03-6 3-(4-methylpiperazin-1-yl)propylamine
4572-03-6 3-(4-methylpiperazin-1-yl)propylamine
| product Name |
3-(4-methylpiperazin-1-yl)propylamine |
| CAS No |
4572-03-6 |
| Synonyms |
1-Piperazinepropanamine, 4-methyl-; 3-(4-Methylpiperazin-1-yl)propan-1-amine; 4-(3-Aminopropyl)-1-methylpiperazine; N-(.gamma.-Aminopropyl)-N'-methylpiperazine; N-Methyl-N'-(.gamma.-aminopropyl)piperazine; N-Methyl-N'-(3-aminopropyl)piperazine; N-Methyl-N'-(gamma-aminopropyl)piperazine; Piperazine, 1-(3-aminopropyl)-4-methyl-; 1-(3-ammoniopropyl)-4-methylpiperazinediium |
| Molecular Formula |
C8H22N3 |
| Molecular Weight |
160.2787 |
| InChI |
InChI=1/C8H19N3/c1-10-5-7-11(8-6-10)4-2-3-9/h2-9H2,1H3/p+3 |
| EINECS |
224-954-4 |
| Molecular Structure |
|
| Boiling point |
230°C at 760 mmHg |
| Flash point |
92°C |
| Vapour Pressur |
0.0674mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
