ChemNet > CAS > 458-92-4 alpha,alpha-Difluoroanisole
458-92-4 alpha,alpha-Difluoroanisole
| product Name |
alpha,alpha-Difluoroanisole |
| CAS No |
458-92-4 |
| Synonyms |
(Difluoromethoxy)benzene |
| Molecular Formula |
C7H6F2O |
| Molecular Weight |
144.1187 |
| InChI |
InChI=1/C7H6F2O/c8-7(9)10-6-4-2-1-3-5-6/h1-5,7H |
| EINECS |
207-283-1 |
| Molecular Structure |
|
| Density |
1.155g/cm3 |
| Boiling point |
138°C at 760 mmHg |
| Refractive index |
1.445 |
| Flash point |
43.1°C |
| Vapour Pressur |
8.52mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
