ChemNet > CAS > 459-47-2 1,4-ethylfluorobenzene
459-47-2 1,4-ethylfluorobenzene
| product Name |
1,4-ethylfluorobenzene |
| CAS No |
459-47-2 |
| Synonyms |
1-Ethyl-4-fluorobenzene; benzene, 1-ethyl-4-fluoro-; Ethyl-4-fluorobenzene |
| Molecular Formula |
C8H9F |
| Molecular Weight |
124.1555 |
| InChI |
InChI=1/C8H9F/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
| Molecular Structure |
|
| Density |
0.981g/cm3 |
| Boiling point |
141.6°C at 760 mmHg |
| Refractive index |
1.477 |
| Flash point |
28.9°C |
| Vapour Pressur |
7.26mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
